ChemNet > CAS > 87223-76-5 אתיל 2-(2-ציאנואנילינו)אצטט
87223-76-5 אתיל 2-(2-ציאנואנילינו)אצטט
שם המוצר |
אתיל 2-(2-ציאנואנילינו)אצטט |
נרדפות |
אתיל N-(2-ציאנופניל)גליצינאט |
שם אנגלי |
ethyl 2-(2-cyanoanilino)acetate;ethyl N-(2-cyanophenyl)glycinate |
מולקולרית פורמולה |
C11H12N2O2 |
משקל מולקולרי |
204.2252 |
InChI |
InChI=1/C11H12N2O2/c1-2-15-11(14)8-13-10-6-4-3-5-9(10)7-12/h3-6,13H,2,8H2,1H3 |
מספר CAS |
87223-76-5 |
מבנה מולקולרי |
|
צפיפות |
1.15g/cm3 |
נקודת רתיחה |
351.1°C at 760 mmHg |
משקל סגולי |
1.538 |
נקודת הבזק |
166.1°C |
לחץ אדים |
4.2E-05mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|