ChemNet > CAS > 93-16-3 Benzene, 1,2-dimethoxy-4-(1-propenyl)-
93-16-3 Benzene, 1,2-dimethoxy-4-(1-propenyl)-
שם המוצר |
Benzene, 1,2-dimethoxy-4-(1-propenyl)- |
שם אנגלי |
Benzene, 1,2-dimethoxy-4-(1-propenyl)-; 1,2-Dimethoxy-4-propen-1-yl benzene; 3,4-Dimethoxy-1,1-propen-1-yl benzene; Isoeugenenyl methyl ether; Isoeugenol methyl ether; Isoeugenyl methyl ether; Methyl isoeugenol; ; 1,2-dimethoxy-4-(prop-1-en-1-yl)benzene; 2-methoxy-3-methyl-4-[(1E)-prop-1-en-1-yl]phenol; 2-methoxy-4-[(1E)-prop-1-en-1-yl]phenol - methoxymethane (1:1); 1,2-dimethoxy-4-[(Z)-prop-1-enyl]benzene |
מולקולרית פורמולה |
C11H14O2 |
משקל מולקולרי |
178.2277 |
InChI |
InChI=1/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4-8H,1-3H3/b5-4- |
מספר CAS |
93-16-3 |
EINECS |
202-224-6 |
מבנה מולקולרי |
|
צפיפות |
0.998g/cm3 |
נקודת ההתוך |
62.6℃ |
נקודת רתיחה |
271.1°C at 760 mmHg |
משקל סגולי |
1.534 |
נקודת הבזק |
104.5°C |
לחץ אדים |
0.011mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/38:Irritating to eyes and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|