933-75-5 2,3,6-Trichlorophenol
שם המוצר |
2,3,6-Trichlorophenol |
שם אנגלי |
2,3,6-Trichlorophenol; |
מולקולרית פורמולה |
C6H3Cl3O |
משקל מולקולרי |
197.4464 |
InChI |
InChI=1/C6H3Cl3O/c7-3-1-2-4(8)6(10)5(3)9/h1-2,10H |
מספר CAS |
933-75-5 |
EINECS |
213-271-7 |
מבנה מולקולרי |
|
צפיפות |
1.596g/cm3 |
נקודת ההתוך |
53-57℃ |
נקודת רתיחה |
230.6°C at 760 mmHg |
משקל סגולי |
1.608 |
נקודת הבזק |
93.3°C |
לחץ אדים |
0.043mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|