ChemNet > CAS > 939-83-3 2-Methyl-5-nitrobenzonitrile
939-83-3 2-Methyl-5-nitrobenzonitrile
שם המוצר |
2-Methyl-5-nitrobenzonitrile |
שם אנגלי |
2-Methyl-5-nitrobenzonitrile; 5-Nitro-o-tolunitrile |
מולקולרית פורמולה |
C8H6N2O2 |
משקל מולקולרי |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c1-6-2-3-8(10(11)12)4-7(6)5-9/h2-4H,1H3 |
מספר CAS |
939-83-3 |
מבנה מולקולרי |
|
צפיפות |
1.26g/cm3 |
נקודת ההתוך |
103.5-107.5℃ |
נקודת רתיחה |
291.5°C at 760 mmHg |
משקל סגולי |
1.568 |
נקודת הבזק |
130.1°C |
לחץ אדים |
0.00194mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|