96-86-6;16798-45-1 Diethyl benzamidomalonate
שם המוצר |
Diethyl benzamidomalonate |
שם אנגלי |
Diethyl benzamidomalonate; Benzamidomalonic acid diethyl ester; diethyl (benzoylamino)propanedioate; diethyl (phenylcarbamoyl)propanedioate |
מולקולרית פורמולה |
C14H17NO5 |
משקל מולקולרי |
279.2885 |
InChI |
InChI=1/C14H17NO5/c1-3-19-13(17)11(14(18)20-4-2)12(16)15-10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3,(H,15,16) |
מספר CAS |
96-86-6;16798-45-1 |
EINECS |
202-540-4 |
מבנה מולקולרי |
|
צפיפות |
1.22g/cm3 |
נקודת רתיחה |
445.8°C at 760 mmHg |
משקל סגולי |
1.54 |
נקודת הבזק |
223.4°C |
לחץ אדים |
3.82E-08mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|