ChemNet > CAS > 96784-54-2 3-Methyl-4-nitrobenzonitrile
96784-54-2 3-Methyl-4-nitrobenzonitrile
שם המוצר |
3-Methyl-4-nitrobenzonitrile |
שם אנגלי |
3-Methyl-4-nitrobenzonitrile; 4-Nitro-m-tolunitrile;
|
מולקולרית פורמולה |
C8H6N2O2 |
משקל מולקולרי |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4H,1H3 |
מספר CAS |
96784-54-2 |
מבנה מולקולרי |
|
צפיפות |
1.26g/cm3 |
נקודת ההתוך |
82-83℃ |
נקודת רתיחה |
322.2°C at 760 mmHg |
משקל סגולי |
1.568 |
נקודת הבזק |
148.6°C |
לחץ אדים |
0.000284mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|