10047-28-6 butyl thioglycolate
उत्पाद का नाम |
butyl thioglycolate |
अंग्रेजी नाम |
butyl thioglycolate; |
आणविक फार्मूला |
C6H12O2S |
आण्विक वजन |
148.2233 |
InChI |
InChI=1/C6H12O2S/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
कैस रजिस्टी संख्या |
10047-28-6 |
EINECS |
233-156-5 |
आणविक संरचना |
|
घनत्व |
1.088g/cm3 |
उबलने का समय |
220.125°C at 760 mmHg |
अपवर्तक सूचकांक |
1.491 |
फ्लैश प्वाइंट |
86.929°C |
वाष्प का दबाव |
0.024mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|