ChemNet > CAS > 100959-19-1 4-Methylcyclohexylamine hydrochloride
100959-19-1 4-Methylcyclohexylamine hydrochloride
| उत्पाद का नाम |
4-Methylcyclohexylamine hydrochloride |
| अंग्रेजी नाम |
4-Methylcyclohexylamine hydrochloride; 1-Amino-4-methylcyclohexane hydrochloride; 4-Methylcycohexylamine hydrochloride; 4-methylcyclohexanamine; 4-methylcyclohexanamine hydrochloride |
| आणविक फार्मूला |
C7H16ClN |
| आण्विक वजन |
149.6616 |
| InChI |
InChI=1/C7H15N.ClH/c1-6-2-4-7(8)5-3-6;/h6-7H,2-5,8H2,1H3;1H |
| कैस रजिस्टी संख्या |
100959-19-1 |
| EINECS |
228-673-8 |
| आणविक संरचना |
|
| उबलने का समय |
195.9°C at 760 mmHg |
| फ्लैश प्वाइंट |
72.3°C |
| वाष्प का दबाव |
0.347mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
