ChemNet > CAS > 10224-72-3 Dimethyl 1,1-cyclobutanedicarboxylate
10224-72-3 Dimethyl 1,1-cyclobutanedicarboxylate
उत्पाद का नाम |
Dimethyl 1,1-cyclobutanedicarboxylate |
अंग्रेजी नाम |
Dimethyl 1,1-cyclobutanedicarboxylate; 1,1-Cyclobutanedicarboxylic acid dimethyl ester; Dimethyl1,1-cyclobutanedicarboxylate, (1,1-Cyclobutanedicarboxylicacid dimethylester); dimethyl cyclobutane-1,1-dicarboxylate |
आणविक फार्मूला |
C8H12O4 |
आण्विक वजन |
172.1785 |
InChI |
InChI=1/C8H12O4/c1-11-6(9)8(4-3-5-8)7(10)12-2/h3-5H2,1-2H3 |
कैस रजिस्टी संख्या |
10224-72-3 |
आणविक संरचना |
|
घनत्व |
1.19g/cm3 |
उबलने का समय |
182.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.468 |
फ्लैश प्वाइंट |
79.5°C |
वाष्प का दबाव |
0.806mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|