103-94-6 4-Nitrophenyloxamic acid
उत्पाद का नाम |
4-Nitrophenyloxamic acid |
अंग्रेजी नाम |
4-Nitrophenyloxamic acid; 4-Nitrooxanilic acid; [(4-nitrophenyl)amino](oxo)acetic acid |
आणविक फार्मूला |
C8H6N2O5 |
आण्विक वजन |
210.1436 |
InChI |
InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13) |
कैस रजिस्टी संख्या |
103-94-6 |
EINECS |
203-160-1 |
आणविक संरचना |
|
घनत्व |
1.629g/cm3 |
अपवर्तक सूचकांक |
1.678 |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|