ChemNet > CAS > 103956-09-8 3,4-Diaminobenzhydrazide
103956-09-8 3,4-Diaminobenzhydrazide
उत्पाद का नाम |
3,4-Diaminobenzhydrazide |
अंग्रेजी नाम |
3,4-Diaminobenzhydrazide;3,4-diaminobenzohydrazide |
आणविक फार्मूला |
C7H10N4O |
आण्विक वजन |
166.1805 |
InChI |
InChI=1/C7H10N4O/c8-5-2-1-4(3-6(5)9)7(12)11-10/h1-3H,8-10H2,(H,11,12) |
कैस रजिस्टी संख्या |
103956-09-8 |
आणविक संरचना |
|
घनत्व |
1.367g/cm3 |
अपवर्तक सूचकांक |
1.705 |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|