105-61-3 N-Carbamoylmaleamic acid
उत्पाद का नाम |
N-Carbamoylmaleamic acid |
अंग्रेजी नाम |
N-Carbamoylmaleamic acid; Maleuric acid; Maleic acid monoureide~Maleuric acid; (2Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid; (2E)-4-(carbamoylamino)-4-oxobut-2-enoic acid; 4-(carbamoylamino)-4-oxobut-2-enoate |
आणविक फार्मूला |
C5H5N2O4 |
आण्विक वजन |
157.1047 |
InChI |
InChI=1/C5H6N2O4/c6-5(11)7-3(8)1-2-4(9)10/h1-2H,(H,9,10)(H3,6,7,8,11)/p-1 |
कैस रजिस्टी संख्या |
105-61-3 |
EINECS |
203-314-8 |
आणविक संरचना |
|
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|