ChemNet > CAS > 1066-38-2 ट्राइमेथिलियोडोगर्मेन
1066-38-2 ट्राइमेथिलियोडोगर्मेन
| उत्पाद का नाम |
ट्राइमेथिलियोडोगर्मेन |
| समानार्थी |
; ट्राइमेथिलगर्मेनियम आयोडाइड; आयोडोट्रिमेथिलगर्मेन; ट्राइमेथिलजर्मनीलियम आयोडाइड |
| अंग्रेजी नाम |
Trimethyliodogermane; Trimethylgermanium iodide; Iodotrimethylgermane; trimethylgermanylium iodide |
| आणविक फार्मूला |
C3H9GeI |
| आण्विक वजन |
244.648 |
| InChI |
InChI=1/C3H9Ge.HI/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 |
| कैस रजिस्टी संख्या |
1066-38-2 |
| आणविक संरचना |
|
| खतरा प्रतीक |
 T:Toxic;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
R61:May cause harm to the unborn child.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
