ChemNet > CAS > 112193-41-6 5-ब्रोमोपाइरीडीन-3-कार्बोहाइड्राज़ाइड
112193-41-6 5-ब्रोमोपाइरीडीन-3-कार्बोहाइड्राज़ाइड
| उत्पाद का नाम |
5-ब्रोमोपाइरीडीन-3-कार्बोहाइड्राज़ाइड |
| अंग्रेजी नाम |
5-bromopyridine-3-carbohydrazide; |
| आणविक फार्मूला |
C6H6BrN3O |
| आण्विक वजन |
216.0353 |
| InChI |
InChI=1/C6H6BrN3O/c7-5-1-4(2-9-3-5)6(11)10-8/h1-3H,8H2,(H,10,11) |
| कैस रजिस्टी संख्या |
112193-41-6 |
| आणविक संरचना |
|
| घनत्व |
1.709g/cm3 |
| गलनांक |
204℃ |
| अपवर्तक सूचकांक |
1.623 |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
