ChemNet > CAS > 1124-39-6 4-Ethylcatechol
1124-39-6 4-Ethylcatechol
| उत्पाद का नाम |
4-Ethylcatechol |
| अंग्रेजी नाम |
4-Ethylcatechol; 3,4-Dihydroxyethylbenzene; 4-ethylbenzene-1,2-diol |
| आणविक फार्मूला |
C8H10O2 |
| आण्विक वजन |
138.1638 |
| InChI |
InChI=1/C8H10O2/c1-2-6-3-4-7(9)8(10)5-6/h3-5,9-10H,2H2,1H3 |
| कैस रजिस्टी संख्या |
1124-39-6 |
| EINECS |
214-397-5 |
| आणविक संरचना |
|
| घनत्व |
1.159g/cm3 |
| उबलने का समय |
273.3°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.578 |
| फ्लैश प्वाइंट |
134.1°C |
| वाष्प का दबाव |
0.00346mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
