ChemNet > CAS > 114152-19-1 2,3,6-trifluorobenzyl alcohol
114152-19-1 2,3,6-trifluorobenzyl alcohol
उत्पाद का नाम |
2,3,6-trifluorobenzyl alcohol |
अंग्रेजी नाम |
2,3,6-trifluorobenzyl alcohol; |
आणविक फार्मूला |
C7H5F3O |
आण्विक वजन |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
कैस रजिस्टी संख्या |
114152-19-1 |
आणविक संरचना |
|
घनत्व |
1.398g/cm3 |
गलनांक |
43-45℃ |
उबलने का समय |
187°C at 760 mmHg |
अपवर्तक सूचकांक |
1.476 |
फ्लैश प्वाइंट |
80.8°C |
वाष्प का दबाव |
0.412mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|