ChemNet > CAS > 117695-55-3 3,5-Dibromobenzeneboronic acid
117695-55-3 3,5-Dibromobenzeneboronic acid
उत्पाद का नाम |
3,5-Dibromobenzeneboronic acid |
अंग्रेजी नाम |
3,5-Dibromobenzeneboronic acid; 3,5-Dibromophenylboronic acid; 3,5-dibrombenzolboronsaeure; 3,5-Dibromophenyl boronic acid |
आणविक फार्मूला |
C6H5BBr2O2 |
आण्विक वजन |
279.7217 |
InChI |
InChI=1/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
कैस रजिस्टी संख्या |
117695-55-3 |
आणविक संरचना |
|
घनत्व |
2.09g/cm3 |
गलनांक |
300℃ |
उबलने का समय |
382.8°C at 760 mmHg |
अपवर्तक सूचकांक |
1.651 |
फ्लैश प्वाइंट |
185.3°C |
वाष्प का दबाव |
1.52E-06mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|