124-48-1 Chlorodibromomethane
उत्पाद का नाम |
Chlorodibromomethane |
अंग्रेजी नाम |
Chlorodibromomethane; Dibromochloromethane |
आणविक फार्मूला |
CHBr2Cl |
आण्विक वजन |
208.2796 |
InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
कैस रजिस्टी संख्या |
124-48-1 |
EINECS |
204-704-0 |
आणविक संरचना |
|
घनत्व |
2.504g/cm3 |
गलनांक |
-22℃ |
उबलने का समय |
117.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.561 |
फ्लैश प्वाइंट |
19.8°C |
वाष्प का दबाव |
21mmHg at 25°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|