ChemNet > CAS > 127913-44-4 (S)-(-)-4-chloro 3-hydroxybutyronitrile
127913-44-4 (S)-(-)-4-chloro 3-hydroxybutyronitrile
| उत्पाद का नाम |
(S)-(-)-4-chloro 3-hydroxybutyronitrile |
| अंग्रेजी नाम |
(S)-(-)-4-chloro 3-hydroxybutyronitrile; (S)-(-)-4-Chloro-3-hydroxybutyronitrile; S-(-)-4-chloro-3-hydorxy butyronitrile; (3S)-4-chloro-3-hydorxybutyronitrile; (3R)-4-chloro-3-hydroxybutanenitrile; (3S)-4-chloro-3-hydroxybutanenitrile; S-(-)-4-Chloro-3-hydroxybutyronitrile; (S)-4-Chloro-3-hydroxybutyronitrile |
| आणविक फार्मूला |
C4H6ClNO |
| आण्विक वजन |
119.5495 |
| InChI |
InChI=1/C4H6ClNO/c5-3-4(7)1-2-6/h4,7H,1,3H2/t4-/m0/s1 |
| कैस रजिस्टी संख्या |
127913-44-4 |
| आणविक संरचना |
|
| घनत्व |
1.229g/cm3 |
| उबलने का समय |
286.2°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.464 |
| फ्लैश प्वाइंट |
126.9°C |
| वाष्प का दबाव |
0.000304mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
