ChemNet > CAS > 13029-09-9 2,2'-Dibromobiphenyl
13029-09-9 2,2'-Dibromobiphenyl
| उत्पाद का नाम |
2,2'-Dibromobiphenyl |
| अंग्रेजी नाम |
2,2'-Dibromobiphenyl; 2,2-Dibromophenyl; 2,2-Dibromobiphenyl; 2,2'-dibromodiphenyl; 2,2'-Dibromo-1,1'-Biphenyl |
| आणविक फार्मूला |
C12H8Br2 |
| आण्विक वजन |
311.9999 |
| InChI |
InChI=1/C12H8Br2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
| कैस रजिस्टी संख्या |
13029-09-9 |
| आणविक संरचना |
|
| घनत्व |
1.667g/cm3 |
| गलनांक |
79℃ |
| उबलने का समय |
332.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.625 |
| फ्लैश प्वाइंट |
180°C |
| वाष्प का दबाव |
0.000274mmHg at 25°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
