ChemNet > CAS > 132741-29-8 Difluoromandelicacid
132741-29-8 Difluoromandelicacid
| उत्पाद का नाम |
Difluoromandelicacid |
| अंग्रेजी नाम |
Difluoromandelicacid; 3,4-Difluoromandelic acid; (3,4-difluorophenyl)(hydroxy)acetic acid |
| आणविक फार्मूला |
C8H6F2O3 |
| आण्विक वजन |
188.1282 |
| InChI |
InChI=1/C8H6F2O3/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| कैस रजिस्टी संख्या |
132741-29-8 |
| आणविक संरचना |
|
| घनत्व |
1.522g/cm3 |
| गलनांक |
92-94℃ |
| उबलने का समय |
320.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.542 |
| फ्लैश प्वाइंट |
147.8°C |
| वाष्प का दबाव |
0.000129mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
