ChemNet > CAS > 13321-74-9 1-ब्रोमो-2,5-डाइमेथॉक्सी-4-मिथाइलबेनज़ीन
13321-74-9 1-ब्रोमो-2,5-डाइमेथॉक्सी-4-मिथाइलबेनज़ीन
| उत्पाद का नाम |
1-ब्रोमो-2,5-डाइमेथॉक्सी-4-मिथाइलबेनज़ीन |
| अंग्रेजी नाम |
1-bromo-2,5-dimethoxy-4-methylbenzene; |
| आणविक फार्मूला |
C9H11BrO2 |
| आण्विक वजन |
231.0864 |
| InChI |
InChI=1/C9H11BrO2/c1-6-4-9(12-3)7(10)5-8(6)11-2/h4-5H,1-3H3 |
| कैस रजिस्टी संख्या |
13321-74-9 |
| आणविक संरचना |
|
| घनत्व |
1.36g/cm3 |
| गलनांक |
77℃ |
| उबलने का समय |
270.4°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.525 |
| फ्लैश प्वाइंट |
114.1°C |
| वाष्प का दबाव |
0.0114mmHg at 25°C |
| खतरा प्रतीक |
Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|