ChemNet > CAS > 13679-72-6 2-acetyl-3-methylthiophene
13679-72-6 2-acetyl-3-methylthiophene
| उत्पाद का नाम |
2-acetyl-3-methylthiophene |
| अंग्रेजी नाम |
2-acetyl-3-methylthiophene; 1-(3-methylthiophen-2-yl)ethanone; 2-acetyl-3-methyl thiophene |
| आणविक फार्मूला |
C7H8OS |
| आण्विक वजन |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
| कैस रजिस्टी संख्या |
13679-72-6 |
| EINECS |
237-179-1 |
| आणविक संरचना |
|
| घनत्व |
1.106g/cm3 |
| उबलने का समय |
214.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.535 |
| फ्लैश प्वाइंट |
92.3°C |
| वाष्प का दबाव |
0.152mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|
