ChemNet > CAS > 13679-73-7 2-Acetyl-4-methylthiophene
13679-73-7 2-Acetyl-4-methylthiophene
| उत्पाद का नाम |
2-Acetyl-4-methylthiophene |
| अंग्रेजी नाम |
2-Acetyl-4-methylthiophene;1-(4-Methyl-2-thienyl)ethan-1-one; AI3-61742; Ethanone, 1-(4-methyl-2-thienyl)-; 1-(4-methylthiophen-2-yl)ethanone |
| आणविक फार्मूला |
C7H8OS |
| आण्विक वजन |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-5-3-7(6(2)8)9-4-5/h3-4H,1-2H3 |
| कैस रजिस्टी संख्या |
13679-73-7 |
| EINECS |
237-180-7 |
| आणविक संरचना |
|
| घनत्व |
1.106g/cm3 |
| उबलने का समय |
236.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.535 |
| फ्लैश प्वाइंट |
97.1°C |
| वाष्प का दबाव |
0.0461mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|
