139-87-7 N-Ethyldiethanolamine
उत्पाद का नाम |
N-Ethyldiethanolamine |
अंग्रेजी नाम |
N-Ethyldiethanolamine; 2,2-(Ethylimino)diethanol; Ethyldiethanolamine; N-ethyl-2-hydroxy-N-(2-hydroxyethyl)ethanaminium |
आणविक फार्मूला |
C6H16NO2 |
आण्विक वजन |
134.1962 |
InChI |
InChI=1/C6H15NO2/c1-2-7(3-5-8)4-6-9/h8-9H,2-6H2,1H3/p+1 |
कैस रजिस्टी संख्या |
139-87-7 |
EINECS |
205-379-8 |
आणविक संरचना |
|
गलनांक |
-50℃ |
उबलने का समय |
246.4°C at 760 mmHg |
फ्लैश प्वाइंट |
123.9°C |
वाष्प का दबाव |
0.00449mmHg at 25°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|