ChemNet > CAS > 1460-18-0 1,15-Pentadecanedioic acid
1460-18-0 1,15-Pentadecanedioic acid
उत्पाद का नाम |
1,15-Pentadecanedioic acid |
अंग्रेजी नाम |
1,15-Pentadecanedioic acid; Pentadecanedioic acid |
आणविक फार्मूला |
C15H28O4 |
आण्विक वजन |
272.3804 |
InChI |
InChI=1/C15H28O4/c16-14(17)12-10-8-6-4-2-1-3-5-7-9-11-13-15(18)19/h1-13H2,(H,16,17)(H,18,19) |
कैस रजिस्टी संख्या |
1460-18-0 |
आणविक संरचना |
|
घनत्व |
1.026g/cm3 |
गलनांक |
113-114℃ |
उबलने का समय |
445.8°C at 760 mmHg |
अपवर्तक सूचकांक |
1.474 |
फ्लैश प्वाइंट |
237.5°C |
वाष्प का दबाव |
3.44E-09mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|