ChemNet > CAS > 1468-82-2 2-bromo-1-(3-thienyl)-1-ethanone
1468-82-2 2-bromo-1-(3-thienyl)-1-ethanone
| उत्पाद का नाम |
2-bromo-1-(3-thienyl)-1-ethanone |
| अंग्रेजी नाम |
2-bromo-1-(3-thienyl)-1-ethanone;2-bromo-1-thiophen-3-ylethanone |
| आणविक फार्मूला |
C6H5BrOS |
| आण्विक वजन |
205.0723 |
| InChI |
InChI=1/C6H5BrOS/c7-3-6(8)5-1-2-9-4-5/h1-2,4H,3H2 |
| कैस रजिस्टी संख्या |
1468-82-2 |
| आणविक संरचना |
|
| घनत्व |
1.658g/cm3 |
| गलनांक |
62℃ |
| उबलने का समय |
247.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.601 |
| फ्लैश प्वाइंट |
103.5°C |
| वाष्प का दबाव |
0.0255mmHg at 25°C |
| खतरा प्रतीक |
 C:Corrosive;
|
| खतरे के कोड |
R34:Causes burns.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
