ChemNet > CAS > 1513-60-6 ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate
1513-60-6 ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate
| उत्पाद का नाम |
ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate |
| अंग्रेजी नाम |
ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate; Ethyl-4,4,4-trifluoro-3-(trifluoromethyl)-crotonate; 4,4,4-Trifluoro-3-(trifluoromethyl)crotonic acid ethyl ester; 1-ethynyl-3,5-difluorobenzene |
| आणविक फार्मूला |
C8H4F2 |
| आण्विक वजन |
138.1142 |
| InChI |
InChI=1/C8H4F2/c1-2-6-3-7(9)5-8(10)4-6/h1,3-5H |
| कैस रजिस्टी संख्या |
1513-60-6 |
| आणविक संरचना |
|
| घनत्व |
1.17g/cm3 |
| उबलने का समय |
147.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.492 |
| फ्लैश प्वाइंट |
32°C |
| वाष्प का दबाव |
5.69mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
