1577-22-6 5-Hexenoic acid
उत्पाद का नाम |
5-Hexenoic acid |
अंग्रेजी नाम |
5-Hexenoic acid;hex-5-enoic acid |
आणविक फार्मूला |
C6H10O2 |
आण्विक वजन |
114.1424 |
InChI |
InChI=1/C6H10O2/c1-2-3-4-5-6(7)8/h2H,1,3-5H2,(H,7,8) |
कैस रजिस्टी संख्या |
1577-22-6 |
आणविक संरचना |
|
घनत्व |
0.973g/cm3 |
उबलने का समय |
202.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.443 |
फ्लैश प्वाइंट |
100.1°C |
वाष्प का दबाव |
0.12mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|