ChemNet > CAS > 158296-69-6 4-Amino-3-chloro-5-methylbenzonitrile
158296-69-6 4-Amino-3-chloro-5-methylbenzonitrile
| उत्पाद का नाम |
4-Amino-3-chloro-5-methylbenzonitrile |
| अंग्रेजी नाम |
4-Amino-3-chloro-5-methylbenzonitrile; 2-Chloro-4-cyano-6-methylaniline |
| आणविक फार्मूला |
C8H7ClN2 |
| आण्विक वजन |
166.6076 |
| InChI |
InChI=1/C8H7ClN2/c1-5-2-6(4-10)3-7(9)8(5)11/h2-3H,11H2,1H3 |
| कैस रजिस्टी संख्या |
158296-69-6 |
| आणविक संरचना |
|
| घनत्व |
1.27g/cm3 |
| उबलने का समय |
302°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.594 |
| फ्लैश प्वाइंट |
136.5°C |
| वाष्प का दबाव |
0.00102mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
