ChemNet > CAS > 1583-59-1 2,2-Difluoro-1,3-benzodioxole
1583-59-1 2,2-Difluoro-1,3-benzodioxole
उत्पाद का नाम |
2,2-Difluoro-1,3-benzodioxole |
अंग्रेजी नाम |
2,2-Difluoro-1,3-benzodioxole; 1,2-[(Difluoromethylene)dioxy]benzene; 2,2-difluorobenzo[d][1,3]dioxole; 2,2-Difluorobenzodioxole; 2,2-Difluoro-2H-1,3-benzodioxole; 2,2-Difluoro-13-benzodioxole |
आणविक फार्मूला |
C7H4F2O2 |
आण्विक वजन |
158.1023 |
InChI |
InChI=1/C7H4F2O2/c8-7(9)10-5-3-1-2-4-6(5)11-7/h1-4H |
कैस रजिस्टी संख्या |
1583-59-1 |
EINECS |
216-431-4 |
आणविक संरचना |
|
घनत्व |
1.42g/cm3 |
उबलने का समय |
125.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.509 |
फ्लैश प्वाइंट |
35.1°C |
वाष्प का दबाव |
15mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|