ChemNet > CAS > 1591-30-6 4,4'-Biphenyldicarbonitrile
1591-30-6 4,4'-Biphenyldicarbonitrile
| उत्पाद का नाम |
4,4'-Biphenyldicarbonitrile |
| अंग्रेजी नाम |
4,4'-Biphenyldicarbonitrile; 4,4-Dicyanobiphenyl; biphenyl-4,4'-dicarbonitrile |
| आणविक फार्मूला |
C14H8N2 |
| आण्विक वजन |
204.2267 |
| InChI |
InChI=1/C14H8N2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H |
| कैस रजिस्टी संख्या |
1591-30-6 |
| EINECS |
216-468-6 |
| आणविक संरचना |
|
| घनत्व |
1.2g/cm3 |
| गलनांक |
236-236℃ |
| उबलने का समय |
403.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.631 |
| फ्लैश प्वाइंट |
199.2°C |
| वाष्प का दबाव |
1.02E-06mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/22:Harmful by inhalation and if swallowed.;
|
| सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
