ChemNet > CAS > 1641-40-3 o-Phenylene phosphorochloridite
1641-40-3 o-Phenylene phosphorochloridite
| उत्पाद का नाम |
o-Phenylene phosphorochloridite |
| अंग्रेजी नाम |
o-Phenylene phosphorochloridite; 1,2-Phenylene phosphorochloridite; Catechyl phosphorus chloride; 2-Chloro-1,3,2-benzodioxaphosphole; phosphorochloridous acid, 1,2-phenylene ester, ion(1-) |
| आणविक फार्मूला |
C6H5Cl2O4P2 |
| आण्विक वजन |
273.9556 |
| InChI |
InChI=1/C6H5Cl2O4P2/c7-13(9)11-5-3-1-2-4-6(5)12-14(8)10/h1-4,9H/q-1 |
| कैस रजिस्टी संख्या |
1641-40-3 |
| EINECS |
216-690-3 |
| आणविक संरचना |
|
| गलनांक |
30-81℃ |
| उबलने का समय |
395.388°C at 760 mmHg |
| फ्लैश प्वाइंट |
192.924°C |
| वाष्प का दबाव |
0mmHg at 25°C |
| खतरा प्रतीक |
 C:Corrosive;
|
| खतरे के कोड |
R34:Causes burns.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
