ChemNet > CAS > 16493-35-9 Undecyl methacrylate
16493-35-9 Undecyl methacrylate
| उत्पाद का नाम |
Undecyl methacrylate |
| अंग्रेजी नाम |
Undecyl methacrylate;2-Propenoic acid, 2-methyl-, undecyl ester; undecyl 2-methylprop-2-enoate |
| आणविक फार्मूला |
C15H28O2 |
| आण्विक वजन |
240.3816 |
| InChI |
InChI=1/C15H28O2/c1-4-5-6-7-8-9-10-11-12-13-17-15(16)14(2)3/h2,4-13H2,1,3H3 |
| कैस रजिस्टी संख्या |
16493-35-9 |
| EINECS |
240-558-4 |
| आणविक संरचना |
|
| घनत्व |
0.875g/cm3 |
| उबलने का समय |
305.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.443 |
| फ्लैश प्वाइंट |
124.4°C |
| वाष्प का दबाव |
0.000797mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
