ChemNet > CAS > 16588-06-0 4-Chloro-3-nitrobenzamide
16588-06-0 4-Chloro-3-nitrobenzamide
| उत्पाद का नाम |
4-Chloro-3-nitrobenzamide |
| अंग्रेजी नाम |
4-Chloro-3-nitrobenzamide;Benzamide, 4-chloro-3-nitro-; 3-Nitro-4-chlorobenzamide; 4-09-00-01227 (Beilstein Handbook Reference); 4-Chlor-3-nitrobenzamid; 4-Chlor-3-nitrobenzamid [Czech]; BRN 0645210; NSC 127825 |
| आणविक फार्मूला |
C7H5ClN2O3 |
| आण्विक वजन |
200.5792 |
| InChI |
InChI=1/C7H5ClN2O3/c8-5-2-1-4(7(9)11)3-6(5)10(12)13/h1-3H,(H2,9,11) |
| कैस रजिस्टी संख्या |
16588-06-0 |
| EINECS |
240-644-1 |
| आणविक संरचना |
|
| घनत्व |
1.52g/cm3 |
| उबलने का समय |
315.6°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.624 |
| फ्लैश प्वाइंट |
144.7°C |
| वाष्प का दबाव |
0.000432mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
