ChemNet > CAS > 16689-02-4 5-Nitrothiophene-2-carbonitrile
16689-02-4 5-Nitrothiophene-2-carbonitrile
| उत्पाद का नाम |
5-Nitrothiophene-2-carbonitrile |
| अंग्रेजी नाम |
5-Nitrothiophene-2-carbonitrile; 2-Cyano-5-nitrothiophene |
| आणविक फार्मूला |
C5H2N2O2S |
| आण्विक वजन |
154.1466 |
| InChI |
InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| कैस रजिस्टी संख्या |
16689-02-4 |
| आणविक संरचना |
|
| घनत्व |
1.5g/cm3 |
| उबलने का समय |
273.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.611 |
| फ्लैश प्वाइंट |
119.4°C |
| वाष्प का दबाव |
0.00558mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
