ChemNet > CAS > 16718-12-0 2-(Phenylthio)thiophene
16718-12-0 2-(Phenylthio)thiophene
| उत्पाद का नाम |
2-(Phenylthio)thiophene |
| अंग्रेजी नाम |
2-(Phenylthio)thiophene; Phenyl 2-thienyl sulphide; 2-(phenylsulfanyl)thiophene; 2-(phenylthio)-thiophene |
| आणविक फार्मूला |
C10H8S2 |
| आण्विक वजन |
192.3005 |
| InChI |
InChI=1/C10H8S2/c1-2-5-9(6-3-1)12-10-7-4-8-11-10/h1-8H |
| कैस रजिस्टी संख्या |
16718-12-0 |
| आणविक संरचना |
|
| घनत्व |
1.24g/cm3 |
| उबलने का समय |
304.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.667 |
| फ्लैश प्वाइंट |
138.1°C |
| वाष्प का दबाव |
0.00155mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
