ChemNet > CAS > 16954-74-8 2-(Dicyanomethylene)indane-1,3-dione
16954-74-8 2-(Dicyanomethylene)indane-1,3-dione
उत्पाद का नाम |
2-(Dicyanomethylene)indane-1,3-dione |
अंग्रेजी नाम |
2-(Dicyanomethylene)indane-1,3-dione; (1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)malononitrile; 2-(Dicyanomethylene)indan-1,3-dione; 2-(Dicyanomethylene)indene-1,3-dione; Propanedinitrile, (1,3-dihydro-1,3-dioxo-2H-inden-2-ylidene)-; Propanedinitrile, 2-(1,3-dihydro-1,3-dioxo-2H-inden-2-ylidene)-; (1,3-dioxo-1,3-dihydro-2H-inden-2-ylidene)propanedinitrile |
आणविक फार्मूला |
C12H4N2O2 |
आण्विक वजन |
208.1724 |
InChI |
InChI=1/C12H4N2O2/c13-5-7(6-14)10-11(15)8-3-1-2-4-9(8)12(10)16/h1-4H |
कैस रजिस्टी संख्या |
16954-74-8 |
आणविक संरचना |
|
घनत्व |
1.485g/cm3 |
उबलने का समय |
347.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.664 |
फ्लैश प्वाइंट |
164.2°C |
वाष्प का दबाव |
5.2E-05mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/22:Harmful by inhalation and if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|