1711-10-0 3-iodobenzoyl chloride

उत्पाद का नाम	3-iodobenzoyl chloride
अंग्रेजी नाम	3-iodobenzoyl chloride;
आणविक फार्मूला	C₇H₄ClIO
आण्विक वजन	266.46
InChI	InChI=1/C7H4ClIO/c8-7(10)5-2-1-3-6(9)4-5/h1-4H
कैस रजिस्टी संख्या	1711-10-0
EINECS	216-979-4
आणविक संरचना
खतरा प्रतीक
खतरे के कोड	R34:Causes burns.;
सुरक्षा विवरण	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;