17356-19-3 1-Ethynylcyclopentanol
उत्पाद का नाम |
1-Ethynylcyclopentanol |
अंग्रेजी नाम |
1-Ethynylcyclopentanol; |
आणविक फार्मूला |
C7H10O |
आण्विक वजन |
110.1537 |
InChI |
InChI=1/C7H10O/c1-2-7(8)5-3-4-6-7/h1,8H,3-6H2 |
कैस रजिस्टी संख्या |
17356-19-3 |
EINECS |
241-385-7 |
आणविक संरचना |
|
घनत्व |
1.01g/cm3 |
गलनांक |
27-159℃ |
उबलने का समय |
155.4°C at 760 mmHg |
अपवर्तक सूचकांक |
1.497 |
फ्लैश प्वाइंट |
48.9°C |
वाष्प का दबाव |
1.1mmHg at 25°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R10:Flammable.;
R22:Harmful if swallowed.;
R36/37:Irritating to eyes and respiratory system.;
|
सुरक्षा विवरण |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|