ChemNet > CAS > 18196-80-0 N-(3-Chlorophenyl)maleamic acid
18196-80-0 N-(3-Chlorophenyl)maleamic acid
उत्पाद का नाम |
N-(3-Chlorophenyl)maleamic acid |
अंग्रेजी नाम |
N-(3-Chlorophenyl)maleamic acid; Maleic acid mono(3-chlorophenyl)amide; (2Z)-4-[(3-chlorophenyl)amino]-4-oxobut-2-enoic acid; (2E)-4-[(3-chlorophenyl)amino]-4-oxobut-2-enoate |
आणविक फार्मूला |
C10H7ClNO3 |
आण्विक वजन |
224.621 |
InChI |
InChI=1/C10H8ClNO3/c11-7-2-1-3-8(6-7)12-9(13)4-5-10(14)15/h1-6H,(H,12,13)(H,14,15)/p-1/b5-4+ |
कैस रजिस्टी संख्या |
18196-80-0 |
आणविक संरचना |
|
उबलने का समय |
463.9°C at 760 mmHg |
फ्लैश प्वाइंट |
234.3°C |
वाष्प का दबाव |
2.1E-09mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|