ChemNet > CAS > 18217-00-0 1-(2-Chloroethyl)-4-methoxybenzene
18217-00-0 1-(2-Chloroethyl)-4-methoxybenzene
| उत्पाद का नाम |
1-(2-Chloroethyl)-4-methoxybenzene |
| अंग्रेजी नाम |
1-(2-Chloroethyl)-4-methoxybenzene; 4-Methoxyphenethyl chloride; 4-(2-chloroethyl)phenyl methyl ether; 2-(4)-Methoxyphenylethylchloride; 4-(2-Chloroethyl)anisole |
| आणविक फार्मूला |
C9H11ClO |
| आण्विक वजन |
170.636 |
| InChI |
InChI=1/C9H11ClO/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5H,6-7H2,1H3 |
| कैस रजिस्टी संख्या |
18217-00-0 |
| EINECS |
242-099-5 |
| आणविक संरचना |
|
| घनत्व |
1.082g/cm3 |
| उबलने का समय |
249.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.512 |
| फ्लैश प्वाइंट |
108.7°C |
| वाष्प का दबाव |
0.0368mmHg at 25°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R22:Harmful if swallowed.;
R36/37:Irritating to eyes and respiratory system.;
R40:Possible risks of irreversible effects.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
