ChemNet > CAS > 18856-63-8 4-Ethylphenyl isothiocyanate
18856-63-8 4-Ethylphenyl isothiocyanate
| उत्पाद का नाम |
4-Ethylphenyl isothiocyanate |
| अंग्रेजी नाम |
4-Ethylphenyl isothiocyanate; 4-Ethylisothiocyanatobenzene; 1-ethyl-4-isothiocyanatobenzene |
| आणविक फार्मूला |
C9H9NS |
| आण्विक वजन |
163.2395 |
| InChI |
InChI=1/C9H9NS/c1-2-8-3-5-9(6-4-8)10-7-11/h3-6H,2H2,1H3 |
| कैस रजिस्टी संख्या |
18856-63-8 |
| आणविक संरचना |
|
| घनत्व |
1.01g/cm3 |
| उबलने का समय |
257.8°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.553 |
| फ्लैश प्वाइंट |
110.2°C |
| वाष्प का दबाव |
0.0229mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
