ChemNet > CAS > 189807-20-3 2,3,6-trifluorobenzoyl chloride
189807-20-3 2,3,6-trifluorobenzoyl chloride
उत्पाद का नाम |
2,3,6-trifluorobenzoyl chloride |
अंग्रेजी नाम |
2,3,6-trifluorobenzoyl chloride; Trifluorobenzoylchloride |
आणविक फार्मूला |
C7H2ClF3O |
आण्विक वजन |
194.5384 |
InChI |
InChI=1/C7H2ClF3O/c8-7(12)5-3(9)1-2-4(10)6(5)11/h1-2H |
कैस रजिस्टी संख्या |
189807-20-3 |
आणविक संरचना |
|
घनत्व |
1.514g/cm3 |
उबलने का समय |
180.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.479 |
फ्लैश प्वाइंट |
59°C |
वाष्प का दबाव |
0.913mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|