ChemNet > CAS > 19250-09-0 1-(3,4-Dichlorophenyl)-2-thiourea
19250-09-0 1-(3,4-Dichlorophenyl)-2-thiourea
उत्पाद का नाम |
1-(3,4-Dichlorophenyl)-2-thiourea |
अंग्रेजी नाम |
1-(3,4-Dichlorophenyl)-2-thiourea; 3,4-Dichlorophenylthiourea; 1-(3,4-dichlorophenyl)thiourea |
आणविक फार्मूला |
C7H6Cl2N2S |
आण्विक वजन |
221.1069 |
InChI |
InChI=1/C7H6Cl2N2S/c8-5-2-1-4(3-6(5)9)11-7(10)12/h1-3H,(H3,10,11,12) |
कैस रजिस्टी संख्या |
19250-09-0 |
EINECS |
242-919-1 |
आणविक संरचना |
|
घनत्व |
1.563g/cm3 |
गलनांक |
210-213℃ |
उबलने का समय |
327.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.73 |
फ्लैश प्वाइंट |
152°C |
वाष्प का दबाव |
0.000198mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|