ChemNet > CAS > 1942-52-5 2-Diethylaminoethanethiol hydrochloride
1942-52-5 2-Diethylaminoethanethiol hydrochloride
| उत्पाद का नाम |
2-Diethylaminoethanethiol hydrochloride |
| अंग्रेजी नाम |
2-Diethylaminoethanethiol hydrochloride; diethyl-2-mercaptoethylammonium chloride; 2-Diethylaminoethanthiol Hydrochloride; 2-(diethylamino)ethanethiol hydrochloride (1:1); N,N-diethyl-2-sulfanylethanaminium |
| आणविक फार्मूला |
C6H16NS |
| आण्विक वजन |
134.2624 |
| InChI |
InChI=1/C6H15NS/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3/p+1 |
| कैस रजिस्टी संख्या |
1942-52-5 |
| EINECS |
217-731-8 |
| आणविक संरचना |
|
| गलनांक |
168-175℃ |
| उबलने का समय |
161.6°C at 760 mmHg |
| फ्लैश प्वाइंट |
51.5°C |
| वाष्प का दबाव |
2.26mmHg at 25°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
