ChemNet > CAS > 19788-49-9 Mercaptopropionicacidethylester
19788-49-9 Mercaptopropionicacidethylester
उत्पाद का नाम |
Mercaptopropionicacidethylester |
अंग्रेजी नाम |
Mercaptopropionicacidethylester; 2-Mercaptopropionic acid ethyl ester; Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester; ethyl 2-sulfanylpropanoate; Ethyl 2-mercaptopropionate |
आणविक फार्मूला |
C5H10O2S |
आण्विक वजन |
134.1967 |
InChI |
InChI=1/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3 |
कैस रजिस्टी संख्या |
19788-49-9 |
EINECS |
243-314-5 |
आणविक संरचना |
|
घनत्व |
1.04g/cm3 |
उबलने का समय |
171.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.452 |
फ्लैश प्वाइंट |
57.4°C |
वाष्प का दबाव |
1.38mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|