ChemNet > CAS > 19847-10-0 2-Pyrazinecarbonyl chloride
19847-10-0 2-Pyrazinecarbonyl chloride
उत्पाद का नाम |
2-Pyrazinecarbonyl chloride |
अंग्रेजी नाम |
2-Pyrazinecarbonyl chloride; Pyrazinecarbonyl chloride; Pyrazine-2-carbonyl chloride |
आणविक फार्मूला |
C5H3ClN2O |
आण्विक वजन |
142.5431 |
InChI |
InChI=1/C5H3ClN2O/c6-5(9)4-3-7-1-2-8-4/h1-3H |
कैस रजिस्टी संख्या |
19847-10-0 |
EINECS |
243-367-4 |
आणविक संरचना |
|
घनत्व |
1.393g/cm3 |
गलनांक |
40.9℃ |
उबलने का समय |
214.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.551 |
फ्लैश प्वाइंट |
83.5°C |
वाष्प का दबाव |
0.155mmHg at 25°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|