ChemNet > CAS > 2001-93-6 Dithiouracil
2001-93-6 Dithiouracil
| उत्पाद का नाम |
Dithiouracil |
| अंग्रेजी नाम |
Dithiouracil; 2,4(1H,3H)-Pyrimidinedithione; 2,4-Dithiopyrimidine; pyrimidine-2,4-dithiol; pyrimidine-2,4(1H,3H)-dithione; 2,4-dimercaptopyrimidine |
| आणविक फार्मूला |
C4H4N2S2 |
| आण्विक वजन |
144.218 |
| InChI |
InChI=1/C4H4N2S2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
| कैस रजिस्टी संख्या |
2001-93-6 |
| EINECS |
217-894-5 |
| आणविक संरचना |
|
| घनत्व |
1.5g/cm3 |
| गलनांक |
279-281℃ |
| उबलने का समय |
225.6°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.776 |
| फ्लैश प्वाइंट |
90.3°C |
| वाष्प का दबाव |
0.0855mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
