2050-23-9 Diethyl suberate
उत्पाद का नाम |
Diethyl suberate |
अंग्रेजी नाम |
Diethyl suberate; Diethyl suberate, (Diethyl octanedioate; Suberic acid d; 2050-23-9Diethyl suberate; Diethyl octanedioate~Suberic acid diethyl ester; Octanedioic acid diethyl ester~Suberic acid diethyl ester; diethyl octanedioate |
आणविक फार्मूला |
C12H22O4 |
आण्विक वजन |
230.3007 |
InChI |
InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
कैस रजिस्टी संख्या |
2050-23-9 |
EINECS |
218-084-4 |
आणविक संरचना |
|
घनत्व |
0.985g/cm3 |
गलनांक |
5-284℃ |
उबलने का समय |
282.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.436 |
फ्लैश प्वाइंट |
123.3°C |
वाष्प का दबाव |
0.00332mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|